C21H25NO6S — CID 87373080
(3S)-4-butoxy-4-oxo-3-[(2-phenylbenzoyl)amino]butane-1-sulfonic acid (PubChem CID 87373080) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is (3S)-4-butoxy-4-oxo-3-[(2-phenylbenzoyl)amino]butane-1-sulfonic acid.
| Compound Name | (3S)-4-butoxy-4-oxo-3-[(2-phenylbenzoyl)amino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87373080 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (3S)-4-butoxy-4-oxo-3-[(2-phenylbenzoyl)amino]butane-1-sulfonic acid |
| SMILES | CCCCOC(=O)[C@H](CCS(=O)(=O)O)NC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H25NO6S/c1-2-3-14-28-21(24)19(13-15-29(25,26)27)22-20(23)18-12-8-7-11-17(18)16-9-5-4-6-10-16/h4-12,19H,2-3,13-15H2,1H3,(H,22,23)(H,25,26,27)/t19-/m0/s1 |
| InChIKey | JNXXLFMGISKMJT-IBGZPJMESA-N |
| XLogP | 3.07 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|