C19H21NO7S — CID 89123680
(2S)-2-[(2-ethoxy-6-phenylbenzoyl)amino]-4-sulfobutanoic acid (PubChem CID 89123680) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is (2S)-2-[(2-ethoxy-6-phenylbenzoyl)amino]-4-sulfobutanoic acid.
| Compound Name | (2S)-2-[(2-ethoxy-6-phenylbenzoyl)amino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 89123680 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (2S)-2-[(2-ethoxy-6-phenylbenzoyl)amino]-4-sulfobutanoic acid |
| SMILES | CCOc1cccc(-c2ccccc2)c1C(=O)N[C@@H](CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C19H21NO7S/c1-2-27-16-10-6-9-14(13-7-4-3-5-8-13)17(16)18(21)20-15(19(22)23)11-12-28(24,25)26/h3-10,15H,2,11-12H2,1H3,(H,20,21)(H,22,23)(H,24,25,26)/t15-/m0/s1 |
| InChIKey | FVTXOEFFORWXCF-HNNXBMFYSA-N |
| XLogP | 2.21 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|