C17H19NO7S — CID 89123836
(2S)-2-[(2-ethoxynaphthalene-1-carbonyl)amino]-4-sulfobutanoic acid (PubChem CID 89123836) has the molecular formula C17H19NO7S and a molecular weight of 381.41 g/mol. Its IUPAC name is (2S)-2-[(2-ethoxynaphthalene-1-carbonyl)amino]-4-sulfobutanoic acid.
| Compound Name | (2S)-2-[(2-ethoxynaphthalene-1-carbonyl)amino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 89123836 |
| Molecular Formula | C17H19NO7S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (2S)-2-[(2-ethoxynaphthalene-1-carbonyl)amino]-4-sulfobutanoic acid |
| SMILES | CCOc1ccc2ccccc2c1C(=O)N[C@@H](CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C17H19NO7S/c1-2-25-14-8-7-11-5-3-4-6-12(11)15(14)16(19)18-13(17(20)21)9-10-26(22,23)24/h3-8,13H,2,9-10H2,1H3,(H,18,19)(H,20,21)(H,22,23,24)/t13-/m0/s1 |
| InChIKey | NNQLTYSMFVFRPU-ZDUSSCGKSA-N |
| XLogP | 1.70 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|