C14H14N2O6S — CID 142765807
2-[(2-aminonaphthalene-1-carbonyl)amino]-3-sulfopropanoic acid (PubChem CID 142765807) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-[(2-aminonaphthalene-1-carbonyl)amino]-3-sulfopropanoic acid.
| Compound Name | 2-[(2-aminonaphthalene-1-carbonyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 142765807 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-[(2-aminonaphthalene-1-carbonyl)amino]-3-sulfopropanoic acid |
| SMILES | Nc1ccc2ccccc2c1C(=O)NC(CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C14H14N2O6S/c15-10-6-5-8-3-1-2-4-9(8)12(10)13(17)16-11(14(18)19)7-23(20,21)22/h1-6,11H,7,15H2,(H,16,17)(H,18,19)(H,20,21,22) |
| InChIKey | PQVAHGDZJFZHCX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|