C11H13NO7S — CID 89123775
2-[(3-methoxybenzoyl)amino]-3-sulfopropanoic acid (PubChem CID 89123775) has the molecular formula C11H13NO7S and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-[(3-methoxybenzoyl)amino]-3-sulfopropanoic acid.
| Compound Name | 2-[(3-methoxybenzoyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 89123775 |
| Molecular Formula | C11H13NO7S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[(3-methoxybenzoyl)amino]-3-sulfopropanoic acid |
| SMILES | COc1cccc(C(=O)NC(CS(=O)(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C11H13NO7S/c1-19-8-4-2-3-7(5-8)10(13)12-9(11(14)15)6-20(16,17)18/h2-5,9H,6H2,1H3,(H,12,13)(H,14,15)(H,16,17,18) |
| InChIKey | HDRJLEJCGWYPOY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|