C15H15NO7S — CID 142765800
2-[(2-methoxynaphthalene-1-carbonyl)amino]-3-sulfopropanoic acid (PubChem CID 142765800) has the molecular formula C15H15NO7S and a molecular weight of 353.35 g/mol. Its IUPAC name is 2-[(2-methoxynaphthalene-1-carbonyl)amino]-3-sulfopropanoic acid.
| Compound Name | 2-[(2-methoxynaphthalene-1-carbonyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 142765800 |
| Molecular Formula | C15H15NO7S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-[(2-methoxynaphthalene-1-carbonyl)amino]-3-sulfopropanoic acid |
| SMILES | COc1ccc2ccccc2c1C(=O)NC(CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C15H15NO7S/c1-23-12-7-6-9-4-2-3-5-10(9)13(12)14(17)16-11(15(18)19)8-24(20,21)22/h2-7,11H,8H2,1H3,(H,16,17)(H,18,19)(H,20,21,22) |
| InChIKey | HPZMFGWROAJNIF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|