C14H19NO6S — CID 87371235
(2R)-2-[(2-butylbenzoyl)amino]-3-sulfopropanoic acid (PubChem CID 87371235) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is (2R)-2-[(2-butylbenzoyl)amino]-3-sulfopropanoic acid.
| Compound Name | (2R)-2-[(2-butylbenzoyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 87371235 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (2R)-2-[(2-butylbenzoyl)amino]-3-sulfopropanoic acid |
| SMILES | CCCCc1ccccc1C(=O)N[C@@H](CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C14H19NO6S/c1-2-3-6-10-7-4-5-8-11(10)13(16)15-12(14(17)18)9-22(19,20)21/h4-5,7-8,12H,2-3,6,9H2,1H3,(H,15,16)(H,17,18)(H,19,20,21)/t12-/m0/s1 |
| InChIKey | JFOUIOYYESVYMZ-LBPRGKRZSA-N |
| XLogP | 1.10 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|