C11H12FNO6S — CID 89123607
2-[[2-(2-fluorophenyl)acetyl]amino]-3-sulfopropanoic acid (PubChem CID 89123607) has the molecular formula C11H12FNO6S and a molecular weight of 305.28 g/mol. Its IUPAC name is 2-[[2-(2-fluorophenyl)acetyl]amino]-3-sulfopropanoic acid.
| Compound Name | 2-[[2-(2-fluorophenyl)acetyl]amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 89123607 |
| Molecular Formula | C11H12FNO6S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2-[[2-(2-fluorophenyl)acetyl]amino]-3-sulfopropanoic acid |
| SMILES | O=C(Cc1ccccc1F)NC(CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C11H12FNO6S/c12-8-4-2-1-3-7(8)5-10(14)13-9(11(15)16)6-20(17,18)19/h1-4,9H,5-6H2,(H,13,14)(H,15,16)(H,17,18,19) |
| InChIKey | AIYKVFWDSRFNPS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|