C15H19NO7S — CID 87371207
(2R)-2-[(5-oxo-6-phenylhexanoyl)amino]-3-sulfopropanoic acid (PubChem CID 87371207) has the molecular formula C15H19NO7S and a molecular weight of 357.38 g/mol. Its IUPAC name is (2R)-2-[(5-oxo-6-phenylhexanoyl)amino]-3-sulfopropanoic acid.
| Compound Name | (2R)-2-[(5-oxo-6-phenylhexanoyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 87371207 |
| Molecular Formula | C15H19NO7S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (2R)-2-[(5-oxo-6-phenylhexanoyl)amino]-3-sulfopropanoic acid |
| SMILES | O=C(CCCC(=O)N[C@@H](CS(=O)(=O)O)C(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO7S/c17-12(9-11-5-2-1-3-6-11)7-4-8-14(18)16-13(15(19)20)10-24(21,22)23/h1-3,5-6,13H,4,7-10H2,(H,16,18)(H,19,20)(H,21,22,23)/t13-/m0/s1 |
| InChIKey | AIVUSOWFQSTINS-ZDUSSCGKSA-N |
| XLogP | 0.43 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|