C20H21NO7S — CID 87372940
(2R)-2-[[5-oxo-5-(2-phenylphenyl)pentanoyl]amino]-3-sulfopropanoic acid (PubChem CID 87372940) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is (2R)-2-[[5-oxo-5-(2-phenylphenyl)pentanoyl]amino]-3-sulfopropanoic acid.
| Compound Name | (2R)-2-[[5-oxo-5-(2-phenylphenyl)pentanoyl]amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 87372940 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (2R)-2-[[5-oxo-5-(2-phenylphenyl)pentanoyl]amino]-3-sulfopropanoic acid |
| SMILES | O=C(CCCC(=O)c1ccccc1-c1ccccc1)N[C@@H](CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C20H21NO7S/c22-18(16-10-5-4-9-15(16)14-7-2-1-3-8-14)11-6-12-19(23)21-17(20(24)25)13-29(26,27)28/h1-5,7-10,17H,6,11-13H2,(H,21,23)(H,24,25)(H,26,27,28)/t17-/m0/s1 |
| InChIKey | PMXBBXNRNLJNAE-KRWDZBQOSA-N |
| XLogP | 2.16 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|