C22H25NO7S — CID 149150770
(2R)-2-[hexanoyl-(2-phenylbenzoyl)amino]-3-sulfopropanoic acid (PubChem CID 149150770) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is (2R)-2-[hexanoyl-(2-phenylbenzoyl)amino]-3-sulfopropanoic acid.
| Compound Name | (2R)-2-[hexanoyl-(2-phenylbenzoyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 149150770 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (2R)-2-[hexanoyl-(2-phenylbenzoyl)amino]-3-sulfopropanoic acid |
| SMILES | CCCCCC(=O)N(C(=O)c1ccccc1-c1ccccc1)[C@@H](CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C22H25NO7S/c1-2-3-5-14-20(24)23(19(22(26)27)15-31(28,29)30)21(25)18-13-9-8-12-17(18)16-10-6-4-7-11-16/h4,6-13,19H,2-3,5,14-15H2,1H3,(H,26,27)(H,28,29,30)/t19-/m0/s1 |
| InChIKey | NTZZWFAEEXWJMM-IBGZPJMESA-N |
| XLogP | 3.24 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|