C9H17NO6S — CID 21395635
2-[butanoyl(ethyl)amino]-3-sulfopropanoic acid (PubChem CID 21395635) has the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-[butanoyl(ethyl)amino]-3-sulfopropanoic acid.
| Compound Name | 2-[butanoyl(ethyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 21395635 |
| Molecular Formula | C9H17NO6S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-[butanoyl(ethyl)amino]-3-sulfopropanoic acid |
| SMILES | CCCC(=O)N(CC)C(CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C9H17NO6S/c1-3-5-8(11)10(4-2)7(9(12)13)6-17(14,15)16/h7H,3-6H2,1-2H3,(H,12,13)(H,14,15,16) |
| InChIKey | YAPNMAOVKAEFFM-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|