C19H19NO7S — CID 87371972
(2R)-2-[[4-oxo-4-(2-phenylphenyl)butanoyl]amino]-3-sulfopropanoic acid (PubChem CID 87371972) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is (2R)-2-[[4-oxo-4-(2-phenylphenyl)butanoyl]amino]-3-sulfopropanoic acid.
| Compound Name | (2R)-2-[[4-oxo-4-(2-phenylphenyl)butanoyl]amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 87371972 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (2R)-2-[[4-oxo-4-(2-phenylphenyl)butanoyl]amino]-3-sulfopropanoic acid |
| SMILES | O=C(CCC(=O)c1ccccc1-c1ccccc1)N[C@@H](CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C19H19NO7S/c21-17(10-11-18(22)20-16(19(23)24)12-28(25,26)27)15-9-5-4-8-14(15)13-6-2-1-3-7-13/h1-9,16H,10-12H2,(H,20,22)(H,23,24)(H,25,26,27)/t16-/m0/s1 |
| InChIKey | FYXBMHXFVDZLJN-INIZCTEOSA-N |
| XLogP | 1.77 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|