C11H10F3NO6S — CID 87371343
3-sulfo-2-[[2-(trifluoromethyl)benzoyl]amino]propanoic acid (PubChem CID 87371343) has the molecular formula C11H10F3NO6S and a molecular weight of 341.26 g/mol. Its IUPAC name is 3-sulfo-2-[[2-(trifluoromethyl)benzoyl]amino]propanoic acid.
| Compound Name | 3-sulfo-2-[[2-(trifluoromethyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87371343 |
| Molecular Formula | C11H10F3NO6S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 3-sulfo-2-[[2-(trifluoromethyl)benzoyl]amino]propanoic acid |
| SMILES | O=C(NC(CS(=O)(=O)O)C(=O)O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO6S/c12-11(13,14)7-4-2-1-3-6(7)9(16)15-8(10(17)18)5-22(19,20)21/h1-4,8H,5H2,(H,15,16)(H,17,18)(H,19,20,21) |
| InChIKey | NYZJQMZUWTZXBX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|