C18H16F3NO6S — CID 89123726
(2S)-4-sulfo-2-[[2-[2-(trifluoromethyl)phenyl]benzoyl]amino]butanoic acid (PubChem CID 89123726) has the molecular formula C18H16F3NO6S and a molecular weight of 431.39 g/mol. Its IUPAC name is (2S)-4-sulfo-2-[[2-[2-(trifluoromethyl)phenyl]benzoyl]amino]butanoic acid.
| Compound Name | (2S)-4-sulfo-2-[[2-[2-(trifluoromethyl)phenyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 89123726 |
| Molecular Formula | C18H16F3NO6S |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | (2S)-4-sulfo-2-[[2-[2-(trifluoromethyl)phenyl]benzoyl]amino]butanoic acid |
| SMILES | O=C(N[C@@H](CCS(=O)(=O)O)C(=O)O)c1ccccc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO6S/c19-18(20,21)14-8-4-3-6-12(14)11-5-1-2-7-13(11)16(23)22-15(17(24)25)9-10-29(26,27)28/h1-8,15H,9-10H2,(H,22,23)(H,24,25)(H,26,27,28)/t15-/m0/s1 |
| InChIKey | LAIYDOIKDNJNTM-HNNXBMFYSA-N |
| XLogP | 2.83 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|