C17H25NO6S — CID 87371983
(2S)-2-[(2-hexylbenzoyl)amino]-4-sulfobutanoic acid (PubChem CID 87371983) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is (2S)-2-[(2-hexylbenzoyl)amino]-4-sulfobutanoic acid.
| Compound Name | (2S)-2-[(2-hexylbenzoyl)amino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 87371983 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (2S)-2-[(2-hexylbenzoyl)amino]-4-sulfobutanoic acid |
| SMILES | CCCCCCc1ccccc1C(=O)N[C@@H](CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C17H25NO6S/c1-2-3-4-5-8-13-9-6-7-10-14(13)16(19)18-15(17(20)21)11-12-25(22,23)24/h6-7,9-10,15H,2-5,8,11-12H2,1H3,(H,18,19)(H,20,21)(H,22,23,24)/t15-/m0/s1 |
| InChIKey | RINPUQMGPAIEHV-HNNXBMFYSA-N |
| XLogP | 2.27 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|