C17H25NO6S — CID 89123469
(3S)-3-[(2-butylbenzoyl)amino]-4-ethoxy-4-oxobutane-1-sulfonic acid (PubChem CID 89123469) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is (3S)-3-[(2-butylbenzoyl)amino]-4-ethoxy-4-oxobutane-1-sulfonic acid.
| Compound Name | (3S)-3-[(2-butylbenzoyl)amino]-4-ethoxy-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 89123469 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (3S)-3-[(2-butylbenzoyl)amino]-4-ethoxy-4-oxobutane-1-sulfonic acid |
| SMILES | CCCCc1ccccc1C(=O)N[C@@H](CCS(=O)(=O)O)C(=O)OCC |
| InChI | InChI=1S/C17H25NO6S/c1-3-5-8-13-9-6-7-10-14(13)16(19)18-15(17(20)24-4-2)11-12-25(21,22)23/h6-7,9-10,15H,3-5,8,11-12H2,1-2H3,(H,18,19)(H,21,22,23)/t15-/m0/s1 |
| InChIKey | NYQJKSXXZARPPF-HNNXBMFYSA-N |
| XLogP | 1.97 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|