C15H21NO6S — CID 87372260
(3S)-4-oxo-3-[(2-phenylacetyl)amino]-4-propoxybutane-1-sulfonic acid (PubChem CID 87372260) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is (3S)-4-oxo-3-[(2-phenylacetyl)amino]-4-propoxybutane-1-sulfonic acid.
| Compound Name | (3S)-4-oxo-3-[(2-phenylacetyl)amino]-4-propoxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 87372260 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (3S)-4-oxo-3-[(2-phenylacetyl)amino]-4-propoxybutane-1-sulfonic acid |
| SMILES | CCCOC(=O)[C@H](CCS(=O)(=O)O)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO6S/c1-2-9-22-15(18)13(8-10-23(19,20)21)16-14(17)11-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3,(H,16,17)(H,19,20,21)/t13-/m0/s1 |
| InChIKey | OMWZFABKEGLHRL-ZDUSSCGKSA-N |
| XLogP | 0.94 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|