C22H33N3O6 — CID 176836509
dipropyl 2-[[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]amino]pentanedioate (PubChem CID 176836509) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is dipropyl 2-[[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]amino]pentanedioate.
| Compound Name | dipropyl 2-[[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 176836509 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | dipropyl 2-[[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]amino]pentanedioate |
| SMILES | CCCOC(=O)CCC(NC(=O)CNC(=O)C(N)Cc1ccccc1)C(=O)OCCC |
| InChI | InChI=1S/C22H33N3O6/c1-3-12-30-20(27)11-10-18(22(29)31-13-4-2)25-19(26)15-24-21(28)17(23)14-16-8-6-5-7-9-16/h5-9,17-18H,3-4,10-15,23H2,1-2H3,(H,24,28)(H,25,26) |
| InChIKey | QWXXNAAJOVZMEU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |