C18H27N3O5 — CID 164795124
butyl 2-[[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetate (PubChem CID 164795124) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is butyl 2-[[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetate.
| Compound Name | butyl 2-[[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetate |
|---|---|
| PubChem CID | 164795124 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | butyl 2-[[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetate |
| SMILES | CCCCOC(=O)COCNC(=O)CNC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C18H27N3O5/c1-2-3-9-26-17(23)12-25-13-21-16(22)11-20-18(24)15(19)10-14-7-5-4-6-8-14/h4-8,15H,2-3,9-13,19H2,1H3,(H,20,24)(H,21,22)/t15-/m0/s1 |
| InChIKey | ZACVWACOELOOAF-HNNXBMFYSA-N |
| XLogP | 0.11 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|