C18H19NO6S — CID 89123732
(2S)-2-[(2-methyl-6-phenylbenzoyl)amino]-4-sulfobutanoic acid (PubChem CID 89123732) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is (2S)-2-[(2-methyl-6-phenylbenzoyl)amino]-4-sulfobutanoic acid.
| Compound Name | (2S)-2-[(2-methyl-6-phenylbenzoyl)amino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 89123732 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2S)-2-[(2-methyl-6-phenylbenzoyl)amino]-4-sulfobutanoic acid |
| SMILES | Cc1cccc(-c2ccccc2)c1C(=O)N[C@@H](CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C18H19NO6S/c1-12-6-5-9-14(13-7-3-2-4-8-13)16(12)17(20)19-15(18(21)22)10-11-26(23,24)25/h2-9,15H,10-11H2,1H3,(H,19,20)(H,21,22)(H,23,24,25)/t15-/m0/s1 |
| InChIKey | DTRLPGAIRZOSGT-HNNXBMFYSA-N |
| XLogP | 2.12 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|