C14H17NO7S — CID 87372869
(2R)-2-[(2-methyl-4-oxo-4-phenylbutanoyl)amino]-3-sulfopropanoic acid (PubChem CID 87372869) has the molecular formula C14H17NO7S and a molecular weight of 343.36 g/mol. Its IUPAC name is (2R)-2-[(2-methyl-4-oxo-4-phenylbutanoyl)amino]-3-sulfopropanoic acid.
| Compound Name | (2R)-2-[(2-methyl-4-oxo-4-phenylbutanoyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 87372869 |
| Molecular Formula | C14H17NO7S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (2R)-2-[(2-methyl-4-oxo-4-phenylbutanoyl)amino]-3-sulfopropanoic acid |
| SMILES | CC(CC(=O)c1ccccc1)C(=O)N[C@@H](CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C14H17NO7S/c1-9(7-12(16)10-5-3-2-4-6-10)13(17)15-11(14(18)19)8-23(20,21)22/h2-6,9,11H,7-8H2,1H3,(H,15,17)(H,18,19)(H,20,21,22)/t9?,11-/m0/s1 |
| InChIKey | RWLXXTDILOILPB-UMJHXOGRSA-N |
| XLogP | 0.35 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|