C13H17NO6S — CID 87373232
(2R)-2-[2-(4-methylphenyl)propanoylamino]-3-sulfopropanoic acid (PubChem CID 87373232) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is (2R)-2-[2-(4-methylphenyl)propanoylamino]-3-sulfopropanoic acid.
| Compound Name | (2R)-2-[2-(4-methylphenyl)propanoylamino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 87373232 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (2R)-2-[2-(4-methylphenyl)propanoylamino]-3-sulfopropanoic acid |
| SMILES | Cc1ccc(C(C)C(=O)N[C@@H](CS(=O)(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H17NO6S/c1-8-3-5-10(6-4-8)9(2)12(15)14-11(13(16)17)7-21(18,19)20/h3-6,9,11H,7H2,1-2H3,(H,14,15)(H,16,17)(H,18,19,20)/t9?,11-/m0/s1 |
| InChIKey | PTLVLPIAWWZMGK-UMJHXOGRSA-N |
| XLogP | 0.56 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|