C12H15NO7S — CID 89123823
(2R)-2-[(2-methoxy-2-phenylacetyl)amino]-3-sulfopropanoic acid (PubChem CID 89123823) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is (2R)-2-[(2-methoxy-2-phenylacetyl)amino]-3-sulfopropanoic acid.
| Compound Name | (2R)-2-[(2-methoxy-2-phenylacetyl)amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 89123823 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2R)-2-[(2-methoxy-2-phenylacetyl)amino]-3-sulfopropanoic acid |
| SMILES | COC(C(=O)N[C@@H](CS(=O)(=O)O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO7S/c1-20-10(8-5-3-2-4-6-8)11(14)13-9(12(15)16)7-21(17,18)19/h2-6,9-10H,7H2,1H3,(H,13,14)(H,15,16)(H,17,18,19)/t9-,10?/m0/s1 |
| InChIKey | JDCXIAQSJYUTIV-RGURZIINSA-N |
| XLogP | -0.17 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|