C16H23NO7S — CID 89123651
(2R)-3-ethoxy-3-oxo-2-[(2-phenyl-2-propoxyacetyl)amino]propane-1-sulfonic acid (PubChem CID 89123651) has the molecular formula C16H23NO7S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R)-3-ethoxy-3-oxo-2-[(2-phenyl-2-propoxyacetyl)amino]propane-1-sulfonic acid.
| Compound Name | (2R)-3-ethoxy-3-oxo-2-[(2-phenyl-2-propoxyacetyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89123651 |
| Molecular Formula | C16H23NO7S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (2R)-3-ethoxy-3-oxo-2-[(2-phenyl-2-propoxyacetyl)amino]propane-1-sulfonic acid |
| SMILES | CCCOC(C(=O)N[C@@H](CS(=O)(=O)O)C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C16H23NO7S/c1-3-10-24-14(12-8-6-5-7-9-12)15(18)17-13(11-25(20,21)22)16(19)23-4-2/h5-9,13-14H,3-4,10-11H2,1-2H3,(H,17,18)(H,20,21,22)/t13-,14?/m0/s1 |
| InChIKey | YSWDBCDGQFLLCM-LSLKUGRBSA-N |
| XLogP | 1.09 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|