C20H24BaO10S2 — CID 131880668
CID 131880668 (PubChem CID 131880668) has the molecular formula C20H24BaO10S2 and a molecular weight of 625.86 g/mol.
| Compound Name | CID 131880668 |
|---|---|
| PubChem CID | 131880668 |
| Molecular Formula | C20H24BaO10S2 |
| Molecular Weight | 625.86 g/mol |
| Exact Mass | 625.99 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(c1ccccc1)S(=O)(=O)O.CCOC(=O)C(c1ccccc1)S(=O)(=O)O.[Ba] |
| InChI | InChI=1S/2C10H12O5S.Ba/c2*1-2-15-10(11)9(16(12,13)14)8-6-4-3-5-7-8;/h2*3-7,9H,2H2,1H3,(H,12,13,14); |
| InChIKey | CMZFRLSBFKJZRB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.86 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|