C8H15NO6S — CID 134470772
2-(2,2-dimethylpropanoylamino)-3-sulfopropanoic acid (PubChem CID 134470772) has the molecular formula C8H15NO6S and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-3-sulfopropanoic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 134470772 |
| Molecular Formula | C8H15NO6S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-3-sulfopropanoic acid |
| SMILES | CC(C)(C)C(=O)NC(CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C8H15NO6S/c1-8(2,3)7(12)9-5(6(10)11)4-16(13,14)15/h5H,4H2,1-3H3,(H,9,12)(H,10,11)(H,13,14,15) |
| InChIKey | SSZZZUOSYQMCCX-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|