C10H21NO4S — CID 10562712
(2S)-2-(2,2-dimethylpropanoylamino)-3-methylbutane-1-sulfonic acid (PubChem CID 10562712) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is (2S)-2-(2,2-dimethylpropanoylamino)-3-methylbutane-1-sulfonic acid.
| Compound Name | (2S)-2-(2,2-dimethylpropanoylamino)-3-methylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 10562712 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2S)-2-(2,2-dimethylpropanoylamino)-3-methylbutane-1-sulfonic acid |
| SMILES | CC(C)[C@@H](CS(=O)(=O)O)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO4S/c1-7(2)8(6-16(13,14)15)11-9(12)10(3,4)5/h7-8H,6H2,1-5H3,(H,11,12)(H,13,14,15)/t8-/m1/s1 |
| InChIKey | FZNLFKIGJAMTIB-MRVPVSSYSA-N |
| XLogP | 1.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|