C10H20ClNO3S — CID 114305435
N-(1-chloro-3-methylbutan-2-yl)-2-methyl-2-methylsulfonylpropanamide (PubChem CID 114305435) has the molecular formula C10H20ClNO3S and a molecular weight of 269.79 g/mol. Its IUPAC name is N-(1-chloro-3-methylbutan-2-yl)-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-(1-chloro-3-methylbutan-2-yl)-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 114305435 |
| Molecular Formula | C10H20ClNO3S |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(1-chloro-3-methylbutan-2-yl)-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(C)C(CCl)NC(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H20ClNO3S/c1-7(2)8(6-11)12-9(13)10(3,4)16(5,14)15/h7-8H,6H2,1-5H3,(H,12,13) |
| InChIKey | RUKJRTFUYWRGNX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|