C11H22ClNO3S — CID 106156757
N-(5-chloro-4-methylpentyl)-2-methyl-2-methylsulfonylpropanamide (PubChem CID 106156757) has the molecular formula C11H22ClNO3S and a molecular weight of 283.82 g/mol. Its IUPAC name is N-(5-chloro-4-methylpentyl)-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-(5-chloro-4-methylpentyl)-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 106156757 |
| Molecular Formula | C11H22ClNO3S |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(5-chloro-4-methylpentyl)-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(CCl)CCCNC(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H22ClNO3S/c1-9(8-12)6-5-7-13-10(14)11(2,3)17(4,15)16/h9H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | UVMJMMIQGUEGSJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|