C8H16INO3S — CID 114504386
N-(3-iodopropyl)-2-methyl-2-methylsulfonylpropanamide (PubChem CID 114504386) has the molecular formula C8H16INO3S and a molecular weight of 333.19 g/mol. Its IUPAC name is N-(3-iodopropyl)-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-(3-iodopropyl)-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 114504386 |
| Molecular Formula | C8H16INO3S |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | N-(3-iodopropyl)-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(C)(C(=O)NCCCI)S(C)(=O)=O |
| InChI | InChI=1S/C8H16INO3S/c1-8(2,14(3,12)13)7(11)10-6-4-5-9/h4-6H2,1-3H3,(H,10,11) |
| InChIKey | MIDALPSJEGAHMQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|