C12H23NO5S — CID 115429761
2-ethyl-2-[[(2-methyl-2-methylsulfonylpropanoyl)amino]methyl]butanoic acid (PubChem CID 115429761) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-ethyl-2-[[(2-methyl-2-methylsulfonylpropanoyl)amino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[(2-methyl-2-methylsulfonylpropanoyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 115429761 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-ethyl-2-[[(2-methyl-2-methylsulfonylpropanoyl)amino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNC(=O)C(C)(C)S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C12H23NO5S/c1-6-12(7-2,10(15)16)8-13-9(14)11(3,4)19(5,17)18/h6-8H2,1-5H3,(H,13,14)(H,15,16) |
| InChIKey | QEERQUXZFLQOAV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |