3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid

C10H19NO4 — CID 66173185

IUPAC3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid
SMILESCCC(C)(C)C(=O)NCC(C)(O)C(=O)O
InChIInChI=1S/C10H19NO4/c1-5-9(2,3)7(12)11-6-10(4,15)8(13)14/h15H,5-6H2,1-4H3,(H,11,12)(H,13,14)
InChIKeyWEYMQAZPOQSQJC-UHFFFAOYSA-N
MW217.26 g/mol
LogP0.37
Rot. Bonds5

About 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid

3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid (PubChem CID 66173185) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid
PubChem CID66173185
Molecular FormulaC10H19NO4
Molecular Weight217.26 g/mol
Exact Mass217.13
IUPAC Name3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid
SMILESCCC(C)(C)C(=O)NCC(C)(O)C(=O)O
InChIInChI=1S/C10H19NO4/c1-5-9(2,3)7(12)11-6-10(4,15)8(13)14/h15H,5-6H2,1-4H3,(H,11,12)(H,13,14)
InChIKeyWEYMQAZPOQSQJC-UHFFFAOYSA-N
XLogP0.37
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.26
LogP ≤ 50.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid?
The IUPAC name of 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid (CID 66173185) is 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid.
What is the SMILES notation for 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid?
The canonical SMILES for 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid is CCC(C)(C)C(=O)NCC(C)(O)C(=O)O.
What is the InChIKey of 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid?
The InChIKey is WEYMQAZPOQSQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c1-5-9(2,3)7(12)11-6-10(4,15)8(13)14/h15H,5-6H2,1-4H3,(H,11,12)(H,13,14).
What are the key properties of 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid?
3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid has a molecular weight of 217.26 g/mol, XLogP of 0.37, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylbutanoylamino)-2-hydroxy-2-methylpropanoic acid is sourced from PubChem (CID 66173185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).