C13H28N2O — CID 106140383
N-(5-amino-2,2-dimethylpentyl)-2,2-dimethylbutanamide (PubChem CID 106140383) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is N-(5-amino-2,2-dimethylpentyl)-2,2-dimethylbutanamide.
| Compound Name | N-(5-amino-2,2-dimethylpentyl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 106140383 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N-(5-amino-2,2-dimethylpentyl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NCC(C)(C)CCCN |
| InChI | InChI=1S/C13H28N2O/c1-6-13(4,5)11(16)15-10-12(2,3)8-7-9-14/h6-10,14H2,1-5H3,(H,15,16) |
| InChIKey | TUBIVFIDQRDEIK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |