C13H28N2O — CID 103461615
3-amino-N-(2,2-dimethylbutyl)-2,2,3-trimethylbutanamide (PubChem CID 103461615) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-amino-N-(2,2-dimethylbutyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(2,2-dimethylbutyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 103461615 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 3-amino-N-(2,2-dimethylbutyl)-2,2,3-trimethylbutanamide |
| SMILES | CCC(C)(C)CNC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C13H28N2O/c1-8-11(2,3)9-15-10(16)12(4,5)13(6,7)14/h8-9,14H2,1-7H3,(H,15,16) |
| InChIKey | LGZDVXMCGGBPOB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |