C13H24N2O — CID 103461706
2-cyano-N-(2,2-dimethylbutyl)-2-ethylbutanamide (PubChem CID 103461706) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-cyano-N-(2,2-dimethylbutyl)-2-ethylbutanamide.
| Compound Name | 2-cyano-N-(2,2-dimethylbutyl)-2-ethylbutanamide |
|---|---|
| PubChem CID | 103461706 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-cyano-N-(2,2-dimethylbutyl)-2-ethylbutanamide |
| SMILES | CCC(C)(C)CNC(=O)C(C#N)(CC)CC |
| InChI | InChI=1S/C13H24N2O/c1-6-12(4,5)10-15-11(16)13(7-2,8-3)9-14/h6-8,10H2,1-5H3,(H,15,16) |
| InChIKey | PBBVSKLADDAXJA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |