C12H24N2OS — CID 103461801
2-carbamothioyl-N-(2,2-dimethylbutyl)-2-methylbutanamide (PubChem CID 103461801) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is 2-carbamothioyl-N-(2,2-dimethylbutyl)-2-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-(2,2-dimethylbutyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 103461801 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-carbamothioyl-N-(2,2-dimethylbutyl)-2-methylbutanamide |
| SMILES | CCC(C)(C)CNC(=O)C(C)(CC)C(N)=S |
| InChI | InChI=1S/C12H24N2OS/c1-6-11(3,4)8-14-10(15)12(5,7-2)9(13)16/h6-8H2,1-5H3,(H2,13,16)(H,14,15) |
| InChIKey | VFLWYFXSVYUPMP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|