C13H27N3OS — CID 113270438
2-carbamothioyl-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylbutanamide (PubChem CID 113270438) has the molecular formula C13H27N3OS and a molecular weight of 273.45 g/mol. Its IUPAC name is 2-carbamothioyl-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 113270438 |
| Molecular Formula | C13H27N3OS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 2-carbamothioyl-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)NCC(C)(C)CN(C)C)C(N)=S |
| InChI | InChI=1S/C13H27N3OS/c1-7-13(4,10(14)18)11(17)15-8-12(2,3)9-16(5)6/h7-9H2,1-6H3,(H2,14,18)(H,15,17) |
| InChIKey | HKJIKQGXGWFTJC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|