C12H24N2O3 — CID 65267148
ethyl 3-[(3-amino-2,2,3-trimethylbutanoyl)amino]propanoate (PubChem CID 65267148) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is ethyl 3-[(3-amino-2,2,3-trimethylbutanoyl)amino]propanoate.
| Compound Name | ethyl 3-[(3-amino-2,2,3-trimethylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 65267148 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | ethyl 3-[(3-amino-2,2,3-trimethylbutanoyl)amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C12H24N2O3/c1-6-17-9(15)7-8-14-10(16)11(2,3)12(4,5)13/h6-8,13H2,1-5H3,(H,14,16) |
| InChIKey | RIUYQLOQDQXSDV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |