C9H17ClN2O3 — CID 119708251
ethyl 3-[(1-aminocyclopropanecarbonyl)amino]propanoate;hydrochloride (PubChem CID 119708251) has the molecular formula C9H17ClN2O3 and a molecular weight of 236.70 g/mol. Its IUPAC name is ethyl 3-[(1-aminocyclopropanecarbonyl)amino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[(1-aminocyclopropanecarbonyl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119708251 |
| Molecular Formula | C9H17ClN2O3 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | ethyl 3-[(1-aminocyclopropanecarbonyl)amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCNC(=O)C1(N)CC1.Cl |
| InChI | InChI=1S/C9H16N2O3.ClH/c1-2-14-7(12)3-6-11-8(13)9(10)4-5-9;/h2-6,10H2,1H3,(H,11,13);1H |
| InChIKey | RNOYXMNYMNULSW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |