C12H26N2O2 — CID 65264682
3-amino-N-(3-ethoxypropyl)-2,2,3-trimethylbutanamide (PubChem CID 65264682) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-amino-N-(3-ethoxypropyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(3-ethoxypropyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65264682 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-amino-N-(3-ethoxypropyl)-2,2,3-trimethylbutanamide |
| SMILES | CCOCCCNC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C12H26N2O2/c1-6-16-9-7-8-14-10(15)11(2,3)12(4,5)13/h6-9,13H2,1-5H3,(H,14,15) |
| InChIKey | DEBACQIDLASPDQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|