C10H23N3O3S — CID 65266947
3-amino-2,2,3-trimethyl-N-(3-sulfamoylpropyl)butanamide (PubChem CID 65266947) has the molecular formula C10H23N3O3S and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-amino-2,2,3-trimethyl-N-(3-sulfamoylpropyl)butanamide.
| Compound Name | 3-amino-2,2,3-trimethyl-N-(3-sulfamoylpropyl)butanamide |
|---|---|
| PubChem CID | 65266947 |
| Molecular Formula | C10H23N3O3S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-amino-2,2,3-trimethyl-N-(3-sulfamoylpropyl)butanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C10H23N3O3S/c1-9(2,10(3,4)11)8(14)13-6-5-7-17(12,15)16/h5-7,11H2,1-4H3,(H,13,14)(H2,12,15,16) |
| InChIKey | HIDWWPZKWYIPMN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|