C8H14F3N3O5S — CID 79801914
3,3,3-trifluoro-2-methyl-2-(3-sulfamoylpropylcarbamoylamino)propanoic acid (PubChem CID 79801914) has the molecular formula C8H14F3N3O5S and a molecular weight of 321.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(3-sulfamoylpropylcarbamoylamino)propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(3-sulfamoylpropylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 79801914 |
| Molecular Formula | C8H14F3N3O5S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(3-sulfamoylpropylcarbamoylamino)propanoic acid |
| SMILES | CC(NC(=O)NCCCS(N)(=O)=O)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O5S/c1-7(5(15)16,8(9,10)11)14-6(17)13-3-2-4-20(12,18)19/h2-4H2,1H3,(H,15,16)(H2,12,18,19)(H2,13,14,17) |
| InChIKey | FVPRGBQEPHCAKQ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|