C12H26N2O2 — CID 106147988
2-amino-2-ethyl-N-(4-hydroxy-2,2-dimethylbutyl)butanamide (PubChem CID 106147988) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-amino-2-ethyl-N-(4-hydroxy-2,2-dimethylbutyl)butanamide.
| Compound Name | 2-amino-2-ethyl-N-(4-hydroxy-2,2-dimethylbutyl)butanamide |
|---|---|
| PubChem CID | 106147988 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-amino-2-ethyl-N-(4-hydroxy-2,2-dimethylbutyl)butanamide |
| SMILES | CCC(N)(CC)C(=O)NCC(C)(C)CCO |
| InChI | InChI=1S/C12H26N2O2/c1-5-12(13,6-2)10(16)14-9-11(3,4)7-8-15/h15H,5-9,13H2,1-4H3,(H,14,16) |
| InChIKey | FHHVLIZESYXEME-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |