3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid

C11H22N2O3 — CID 115427950

IUPAC3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid
SMILESCCC(N)(CC)C(=O)NCC(C)(C)C(=O)O
InChIInChI=1S/C11H22N2O3/c1-5-11(12,6-2)8(14)13-7-10(3,4)9(15)16/h5-7,12H2,1-4H3,(H,13,14)(H,15,16)
InChIKeyUICOUBJXUDEJQG-UHFFFAOYSA-N
MW230.31 g/mol
LogP0.73
Rot. Bonds6

About 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid

3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid (PubChem CID 115427950) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid
PubChem CID115427950
Molecular FormulaC11H22N2O3
Molecular Weight230.31 g/mol
Exact Mass230.16
IUPAC Name3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid
SMILESCCC(N)(CC)C(=O)NCC(C)(C)C(=O)O
InChIInChI=1S/C11H22N2O3/c1-5-11(12,6-2)8(14)13-7-10(3,4)9(15)16/h5-7,12H2,1-4H3,(H,13,14)(H,15,16)
InChIKeyUICOUBJXUDEJQG-UHFFFAOYSA-N
XLogP0.73
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.31
LogP ≤ 50.73
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid (CID 115427950) is 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid is CCC(N)(CC)C(=O)NCC(C)(C)C(=O)O.
What is the InChIKey of 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid?
The InChIKey is UICOUBJXUDEJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-5-11(12,6-2)8(14)13-7-10(3,4)9(15)16/h5-7,12H2,1-4H3,(H,13,14)(H,15,16).
What are the key properties of 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid?
3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid has a molecular weight of 230.31 g/mol, XLogP of 0.73, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-amino-2-ethylbutanoyl)amino]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 115427950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).