C7H15O2Y- — CID 58937622
carbanide;2,2-dimethylbutanoic acid;yttrium (PubChem CID 58937622) has the molecular formula C7H15O2Y- and a molecular weight of 220.10 g/mol. Its IUPAC name is carbanide;2,2-dimethylbutanoic acid;yttrium.
| Compound Name | carbanide;2,2-dimethylbutanoic acid;yttrium |
|---|---|
| PubChem CID | 58937622 |
| Molecular Formula | C7H15O2Y- |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | carbanide;2,2-dimethylbutanoic acid;yttrium |
| SMILES | CCC(C)(C)C(=O)O.[CH3-].[Y] |
| InChI | InChI=1S/C6H12O2.CH3.Y/c1-4-6(2,3)5(7)8;;/h4H2,1-3H3,(H,7,8);1H3;/q;-1; |
| InChIKey | OBWPCIVDRSLRIH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|