4-hydroxy-2,2,4-trimethylhexanoic acid

C9H18O3 — CID 114495175

IUPAC4-hydroxy-2,2,4-trimethylhexanoic acid
SMILESCCC(C)(O)CC(C)(C)C(=O)O
InChIInChI=1S/C9H18O3/c1-5-9(4,12)6-8(2,3)7(10)11/h12H,5-6H2,1-4H3,(H,10,11)
InChIKeySMZPTUWCDXCBMD-UHFFFAOYSA-N
MW174.24 g/mol
LogP1.65
Rot. Bonds4

About 4-hydroxy-2,2,4-trimethylhexanoic acid

4-hydroxy-2,2,4-trimethylhexanoic acid (PubChem CID 114495175) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 4-hydroxy-2,2,4-trimethylhexanoic acid.

Molecular Properties

Compound Name4-hydroxy-2,2,4-trimethylhexanoic acid
PubChem CID114495175
Molecular FormulaC9H18O3
Molecular Weight174.24 g/mol
Exact Mass174.13
IUPAC Name4-hydroxy-2,2,4-trimethylhexanoic acid
SMILESCCC(C)(O)CC(C)(C)C(=O)O
InChIInChI=1S/C9H18O3/c1-5-9(4,12)6-8(2,3)7(10)11/h12H,5-6H2,1-4H3,(H,10,11)
InChIKeySMZPTUWCDXCBMD-UHFFFAOYSA-N
XLogP1.65
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.24
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-hydroxy-2,2,4-trimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-2,2,4-trimethylhexanoic acid?
The IUPAC name of 4-hydroxy-2,2,4-trimethylhexanoic acid (CID 114495175) is 4-hydroxy-2,2,4-trimethylhexanoic acid.
What is the SMILES notation for 4-hydroxy-2,2,4-trimethylhexanoic acid?
The canonical SMILES for 4-hydroxy-2,2,4-trimethylhexanoic acid is CCC(C)(O)CC(C)(C)C(=O)O.
What is the InChIKey of 4-hydroxy-2,2,4-trimethylhexanoic acid?
The InChIKey is SMZPTUWCDXCBMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-5-9(4,12)6-8(2,3)7(10)11/h12H,5-6H2,1-4H3,(H,10,11).
What are the key properties of 4-hydroxy-2,2,4-trimethylhexanoic acid?
4-hydroxy-2,2,4-trimethylhexanoic acid has a molecular weight of 174.24 g/mol, XLogP of 1.65, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,2,4-trimethylhexanoic acid is sourced from PubChem (CID 114495175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).