C10H17F3O2 — CID 131983342
2,2,4-trimethyl-4-(trifluoromethyl)hexanoic acid (PubChem CID 131983342) has the molecular formula C10H17F3O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-(trifluoromethyl)hexanoic acid.
| Compound Name | 2,2,4-trimethyl-4-(trifluoromethyl)hexanoic acid |
|---|---|
| PubChem CID | 131983342 |
| Molecular Formula | C10H17F3O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,2,4-trimethyl-4-(trifluoromethyl)hexanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O2/c1-5-9(4,10(11,12)13)6-8(2,3)7(14)15/h5-6H2,1-4H3,(H,14,15) |
| InChIKey | OCBWWSJXYFOFHE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |