C10H22ClNO2S — CID 79267130
N-(1-chloro-3-methylbutan-2-yl)-2,2-dimethylpropane-1-sulfonamide (PubChem CID 79267130) has the molecular formula C10H22ClNO2S and a molecular weight of 255.81 g/mol. Its IUPAC name is N-(1-chloro-3-methylbutan-2-yl)-2,2-dimethylpropane-1-sulfonamide.
| Compound Name | N-(1-chloro-3-methylbutan-2-yl)-2,2-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79267130 |
| Molecular Formula | C10H22ClNO2S |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-(1-chloro-3-methylbutan-2-yl)-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)C(CCl)NS(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H22ClNO2S/c1-8(2)9(6-11)12-15(13,14)7-10(3,4)5/h8-9,12H,6-7H2,1-5H3 |
| InChIKey | SMTBVAHJFKRYHF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|