C8H14ClN3O2S — CID 102693971
N-(1-chloro-3-methylbutan-2-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693971) has the molecular formula C8H14ClN3O2S and a molecular weight of 251.74 g/mol. Its IUPAC name is N-(1-chloro-3-methylbutan-2-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(1-chloro-3-methylbutan-2-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693971 |
| Molecular Formula | C8H14ClN3O2S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | N-(1-chloro-3-methylbutan-2-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | CC(C)C(CCl)NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H14ClN3O2S/c1-6(2)7(5-9)12-15(13,14)8-3-4-10-11-8/h3-4,6-7,12H,5H2,1-2H3,(H,10,11) |
| InChIKey | SVOZACLFPBCCGJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|